CAS 24667-21-8 appears in our catalog under these names: Glycyl-d-asparagine, 98%, H–Gly–D–Asn–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
(2R)-4-amino-2-[(2-aminoacetyl)amino]-4-oxobutanoic acid (CAS 24667-21-8) is a chemical compound with the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. IUPAC name: (2R)-4-amino-2-[(2-aminoacetyl)amino]-4-oxobutanoic acid. InChIKey: FUESBOMYALLFNI-GSVOUGTGSA-N.
| Molecular formula | C6H11N3O4 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (2R)-4-amino-2-[(2-aminoacetyl)amino]-4-oxobutanoic acid |
| InChIKey | FUESBOMYALLFNI-GSVOUGTGSA-N |
| SMILES | C([C@H](C(=O)O)NC(=O)CN)C(=O)N |
Computed by PubChem (NCBI)