Products 66347-26-0
CAS 66347-26-0 appears in our catalog under these names: 6-Deoxy-beta-L-galactopyranosyl Azide, β-L-Fucopyranosyl azide. Offered by: TRC, Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg, 50mg.
(2S,3S,4R,5S,6S)-2-azido-6-methyloxane-3,4,5-triol (CAS 66347-26-0) is a chemical compound with the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. IUPAC name: (2S,3S,4R,5S,6S)-2-azido-6-methyloxane-3,4,5-triol. InChIKey: VSGLZXLDOTWWBF-KGJVWPDLSA-N.
| Molecular formula | C6H11N3O4 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (2S,3S,4R,5S,6S)-2-azido-6-methyloxane-3,4,5-triol |
| InChIKey | VSGLZXLDOTWWBF-KGJVWPDLSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)N=[N+]=[N-])O)O)O |
Computed by PubChem (NCBI)