Products 243641-71-6

CAS 243641-71-6 is the registry number for 2-Cyclopropyl-3-(4-methoxyphenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-cyclopropyl-3-(4-methoxyphenyl)propanoic acid (CAS 243641-71-6) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 2-cyclopropyl-3-(4-methoxyphenyl)propanoic acid. InChIKey: WYEXGNPNDCBAGC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O3
Molecular weight220.26 g/mol
IUPAC name2-cyclopropyl-3-(4-methoxyphenyl)propanoic acid
InChIKeyWYEXGNPNDCBAGC-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CC(C2CC2)C(=O)O

Computed by PubChem (NCBI)