CAS 243666-18-4 appears in our catalog under these names: 2',3',6'-Trifluoropropiophenone, 95%, 2',3',6'-Trifluoropropiophenone, 98%+,RG, 98%+,RG. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g, 700mg.
1-(2,3,6-trifluorophenyl)propan-1-one (CAS 243666-18-4) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 1-(2,3,6-trifluorophenyl)propan-1-one. InChIKey: LEDVCRMPYBDECF-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 1-(2,3,6-trifluorophenyl)propan-1-one |
| InChIKey | LEDVCRMPYBDECF-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1F)F)F |
Computed by PubChem (NCBI)