Products 2438240-69-6
CAS 2438240-69-6 is the registry number for Methyl 6-hydroxy-2-naphthoate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(5-bromo-7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2438240-69-6) is a chemical compound with the molecular formula C13H10BrFN2O3 and a molecular weight of 341.13 g/mol. IUPAC name: 3-(5-bromo-7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: FZJASCLDLYKDPK-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFN2O3 |
|---|---|
| Molecular weight | 341.13 g/mol |
| IUPAC name | 3-(5-bromo-7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | FZJASCLDLYKDPK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=C(C=C3F)Br |
Computed by PubChem (NCBI)