CAS 2438241-00-8 is the registry number for 4-Br-7-O-Desamino lenalidomide. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(7-bromo-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2438241-00-8) is a chemical compound with the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. IUPAC name: 3-(7-bromo-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: JMSKDRLRVVKCEK-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O4 |
|---|---|
| Molecular weight | 353.17 g/mol |
| IUPAC name | 3-(7-bromo-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | JMSKDRLRVVKCEK-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Br)CN(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)