CAS 2438242-13-6 appears in our catalog under these names: 3-(6-Bromo-7-methoxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95%, 95%, 3-(6-Bromo-7-methoxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-(5-bromo-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2438242-13-6) is a chemical compound with the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. IUPAC name: 3-(5-bromo-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: AWCOYYRLAUJPCO-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O4 |
|---|---|
| Molecular weight | 353.17 g/mol |
| IUPAC name | 3-(5-bromo-4-methoxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | AWCOYYRLAUJPCO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1C(=O)N(C2)C3CCC(=O)NC3=O)Br |
Computed by PubChem (NCBI)