Products 808736-72-3

CAS 808736-72-3 is the registry number for Dimethyl 1-benzyl-2-bromo-1h-imidazole-4,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 1-benzyl-2-bromoimidazole-4,5-dicarboxylate (CAS 808736-72-3) is a chemical compound with the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. IUPAC name: dimethyl 1-benzyl-2-bromoimidazole-4,5-dicarboxylate. InChIKey: CFWNFRQSWCFWTC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13BrN2O4
Molecular weight353.17 g/mol
IUPAC namedimethyl 1-benzyl-2-bromoimidazole-4,5-dicarboxylate
InChIKeyCFWNFRQSWCFWTC-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(N(C(=N1)Br)CC2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)