CAS 808736-72-3 is the registry number for Dimethyl 1-benzyl-2-bromo-1h-imidazole-4,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Dimethyl 1-benzyl-2-bromoimidazole-4,5-dicarboxylate (CAS 808736-72-3) is a chemical compound with the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. IUPAC name: dimethyl 1-benzyl-2-bromoimidazole-4,5-dicarboxylate. InChIKey: CFWNFRQSWCFWTC-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O4 |
|---|---|
| Molecular weight | 353.17 g/mol |
| IUPAC name | dimethyl 1-benzyl-2-bromoimidazole-4,5-dicarboxylate |
| InChIKey | CFWNFRQSWCFWTC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(C(=N1)Br)CC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)