Products 2438484-05-8
CAS 2438484-05-8 is the registry number for rac-(1R,3R)-1,3-dimethyl-2,3-dihydro-1H-isoindole hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1S,3S)-1,3-dimethyl-2,3-dihydro-1H-isoindole;hydrochloride (CAS 2438484-05-8) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1S,3S)-1,3-dimethyl-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: HIYYPNJCTLRHPV-WSZWBAFRSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1S,3S)-1,3-dimethyl-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | HIYYPNJCTLRHPV-WSZWBAFRSA-N |
| SMILES | C[C@H]1C2=CC=CC=C2[C@@H](N1)C.Cl |
Computed by PubChem (NCBI)