Products 2438941-66-1
CAS 2438941-66-1 is the registry number for Tert-butyl 2,7-diazatricyclo[4.4.0.03,8]decane-2-carboxylate oxalate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 200mg.
Tert-butyl 2,7-diazatricyclo[4.4.0.03,8]decane-2-carboxylate;oxalic acid (CAS 2438941-66-1) is a chemical compound with the molecular formula C15H24N2O6 and a molecular weight of 328.36 g/mol. IUPAC name: tert-butyl 2,7-diazatricyclo[4.4.0.03,8]decane-2-carboxylate;oxalic acid. InChIKey: JMXLBFXNHJMHQR-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O6 |
|---|---|
| Molecular weight | 328.36 g/mol |
| IUPAC name | tert-butyl 2,7-diazatricyclo[4.4.0.03,8]decane-2-carboxylate;oxalic acid |
| InChIKey | JMXLBFXNHJMHQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC3C1CCC2N3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)