CAS 51513-80-5 appears in our catalog under these names: 6-(Boc-amino)caproic acid N-succinimidyl ester, 98%, t-Boc-aminocaproic-N-hydroxysuccinimide, Boc–ε–aminocaproic acid–OSu, 6-[(tert-Butoxycarbonyl)amino]hexanoic Acid N-Succinimidyl Ester, >98.0%(HPLC)(N), 6-[(tert-Butoxycarbonyl)amino]hexanoic Acid N-Succinimidyl Ester 95%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5g, 250mg, 2g, 500mg, 25g, 100mg, 10g.
(2,5-dioxopyrrolidin-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (CAS 51513-80-5) is a chemical compound with the molecular formula C15H24N2O6 and a molecular weight of 328.36 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate. InChIKey: TYJPSIQEEXOQLC-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O6 |
|---|---|
| Molecular weight | 328.36 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| InChIKey | TYJPSIQEEXOQLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)