Products 3392-08-3
CAS 3392-08-3 appears in our catalog under these names: Boc-ile-osu, 98%, Boc–Ile–Osu, Boc-L-Ile-OSu, Boc-Ile-OSu 97%, Boc-Ile-OSu, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 100g, 500g, 25g, 1g, 10g.
(2,5-dioxopyrrolidin-1-yl) (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 3392-08-3) is a chemical compound with the molecular formula C15H24N2O6 and a molecular weight of 328.36 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: FATJLEZSGFVHQA-CABZTGNLSA-N.
| Molecular formula | C15H24N2O6 |
|---|---|
| Molecular weight | 328.36 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | FATJLEZSGFVHQA-CABZTGNLSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)