Products 244094-72-2
CAS 244094-72-2 appears in our catalog under these names: Betahistine Dihydrochloride-d3, Betahistine-d3 Dihydrochloride, >95% (HPLC), Betahistine-d3 2HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Betahistine–d3 dihydrochloride, Betahistine-d3 (dihydrochloride), 99.0%. Offered by: Hubei YoungXin, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 0,01g, 0,005g.
2-pyridin-2-yl-N-(trideuteriomethyl)ethanamine;dihydrochloride (CAS 244094-72-2) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 212.13 g/mol. IUPAC name: 2-pyridin-2-yl-N-(trideuteriomethyl)ethanamine;dihydrochloride. InChIKey: XVDFMHARQUBJRE-GXXYEPOPSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 212.13 g/mol |
| IUPAC name | 2-pyridin-2-yl-N-(trideuteriomethyl)ethanamine;dihydrochloride |
| InChIKey | XVDFMHARQUBJRE-GXXYEPOPSA-N |
| SMILES | [2H]C([2H])([2H])NCCC1=CC=CC=N1.Cl.Cl |
Computed by PubChem (NCBI)