CAS 244145-40-2 appears in our catalog under these names: (S)-1-(4-Methoxyphenyl)propan-1-amine hydrochloride, 95%, (S)–1–(4–Methoxyphenyl)propan–1–amine hydrochloride, [(1S)-1-(4-methoxyphenyl)propyl]amine hydrochloride, 98%, 98%, (S)-1-(4-Methoxyphenyl)propan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(1S)-1-(4-methoxyphenyl)propan-1-amine;hydrochloride (CAS 244145-40-2) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (1S)-1-(4-methoxyphenyl)propan-1-amine;hydrochloride. InChIKey: MEPAINWSSZGNKL-PPHPATTJSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (1S)-1-(4-methoxyphenyl)propan-1-amine;hydrochloride |
| InChIKey | MEPAINWSSZGNKL-PPHPATTJSA-N |
| SMILES | CC[C@@H](C1=CC=C(C=C1)OC)N.Cl |
Computed by PubChem (NCBI)