Products 2442597-65-9
CAS 2442597-65-9 appears in our catalog under these names: 2-(3-Methoxy-4-nitrophenyl)thiazol-4-amine, 95%, 2–(3–Methoxy–4–nitrophenyl)thiazol–4–amine, 2-(3-Methoxy-4-nitrophenyl)thiazol-4-amine 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 5g, 100mg, 1g.
2-(3-methoxy-4-nitrophenyl)-1,3-thiazol-4-amine (CAS 2442597-65-9) is a chemical compound with the molecular formula C10H9N3O3S and a molecular weight of 251.26 g/mol. IUPAC name: 2-(3-methoxy-4-nitrophenyl)-1,3-thiazol-4-amine. InChIKey: BZYRMMYVFXVEDN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 2-(3-methoxy-4-nitrophenyl)-1,3-thiazol-4-amine |
| InChIKey | BZYRMMYVFXVEDN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NC(=CS2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)