CAS 886496-76-0 appears in our catalog under these names: 1-Methyl-4-(thiophene-2-carboxamido)-1H-imidazole-2-carboxylic acid, 97%, 1-Methyl-4-[(thiophene-2-carbonyl)-amino]-1H-imidazole-2-carboxylic acid, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
1-methyl-4-(thiophene-2-carbonylamino)imidazole-2-carboxylic acid (CAS 886496-76-0) is a chemical compound with the molecular formula C10H9N3O3S and a molecular weight of 251.26 g/mol. IUPAC name: 1-methyl-4-(thiophene-2-carbonylamino)imidazole-2-carboxylic acid. InChIKey: IYVFSBFECHKKJX-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 1-methyl-4-(thiophene-2-carbonylamino)imidazole-2-carboxylic acid |
| InChIKey | IYVFSBFECHKKJX-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=C1C(=O)O)NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)