Products 604740-20-7

CAS 604740-20-7 is the registry number for 3-([5-(4-Pyridinyl)-1,3,4-oxadiazol-2-yl]thio)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid (CAS 604740-20-7) is a chemical compound with the molecular formula C10H9N3O3S and a molecular weight of 251.26 g/mol. IUPAC name: 3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid. InChIKey: HSRJAFMGXXALCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9N3O3S
Molecular weight251.26 g/mol
IUPAC name3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoic acid
InChIKeyHSRJAFMGXXALCQ-UHFFFAOYSA-N
SMILESC1=CN=CC=C1C2=NN=C(O2)SCCC(=O)O

Computed by PubChem (NCBI)