Products 2443970-24-7

CAS 2443970-24-7 is the registry number for Bedaquiline Impurity 3 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(dimethylamino)methyl]-1-naphthalen-1-ylprop-2-en-1-one;hydrochloride (CAS 2443970-24-7) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 275.77 g/mol. IUPAC name: 2-[(dimethylamino)methyl]-1-naphthalen-1-ylprop-2-en-1-one;hydrochloride. InChIKey: CHLIVRUNXHFSSP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18ClNO
Molecular weight275.77 g/mol
IUPAC name2-[(dimethylamino)methyl]-1-naphthalen-1-ylprop-2-en-1-one;hydrochloride
InChIKeyCHLIVRUNXHFSSP-UHFFFAOYSA-N
SMILESCN(C)CC(=C)C(=O)C1=CC=CC2=CC=CC=C21.Cl

Computed by PubChem (NCBI)