CAS 2443970-24-7 is the registry number for Bedaquiline Impurity 3 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(dimethylamino)methyl]-1-naphthalen-1-ylprop-2-en-1-one;hydrochloride (CAS 2443970-24-7) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 275.77 g/mol. IUPAC name: 2-[(dimethylamino)methyl]-1-naphthalen-1-ylprop-2-en-1-one;hydrochloride. InChIKey: CHLIVRUNXHFSSP-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 2-[(dimethylamino)methyl]-1-naphthalen-1-ylprop-2-en-1-one;hydrochloride |
| InChIKey | CHLIVRUNXHFSSP-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=C)C(=O)C1=CC=CC2=CC=CC=C21.Cl |
Computed by PubChem (NCBI)