CAS 42787-67-7 appears in our catalog under these names: N-Phenylmethcathinone Hydrochloride (1.0 mg/mL in Methanol), N-phenylmethcathinone Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 1x1ml, 250mg, 500mg, 50mg.
2-(N-methylanilino)-1-phenylpropan-1-one;hydrochloride (CAS 42787-67-7) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 275.77 g/mol. IUPAC name: 2-(N-methylanilino)-1-phenylpropan-1-one;hydrochloride. InChIKey: NAVAUHSYPSENCC-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 2-(N-methylanilino)-1-phenylpropan-1-one;hydrochloride |
| InChIKey | NAVAUHSYPSENCC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1)N(C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)