CAS 749920-15-8 is the registry number for 2-Chloro-1-(1-(3,5-dimethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone (CAS 749920-15-8) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 275.77 g/mol. IUPAC name: 2-chloro-1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone. InChIKey: TXBANKQTNXOZPT-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 2-chloro-1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| InChIKey | TXBANKQTNXOZPT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C(=CC(=C2C)C(=O)CCl)C)C |
Computed by PubChem (NCBI)