Products 2444010-38-0
CAS 2444010-38-0 appears in our catalog under these names: 4-((Nitrooxy)methyl)phenyl isonicotinate, 95%, 95%, 4-((Nitrooxy)methyl)phenyl isonicotinate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 100mg.
[4-(nitrooxymethyl)phenyl] pyridine-4-carboxylate (CAS 2444010-38-0) is a chemical compound with the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. IUPAC name: [4-(nitrooxymethyl)phenyl] pyridine-4-carboxylate. InChIKey: FCWMEPCULCBSHY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O5 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | [4-(nitrooxymethyl)phenyl] pyridine-4-carboxylate |
| InChIKey | FCWMEPCULCBSHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO[N+](=O)[O-])OC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)