CAS 2444764-03-6 appears in our catalog under these names: GKI-1/ 99.38% (existing batch purity), N-(4-chlorophenyl)-3-(1H-pyrazol-4-yl)aniline, GKI-1, 99.96%, GKI-1 (Standard). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 10 mg.
N-(4-chlorophenyl)-3-(1H-pyrazol-4-yl)aniline (CAS 2444764-03-6) is a chemical compound with the molecular formula C15H12ClN3 and a molecular weight of 269.73 g/mol. IUPAC name: N-(4-chlorophenyl)-3-(1H-pyrazol-4-yl)aniline. InChIKey: GPXJDHFWTOJHQQ-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | N-(4-chlorophenyl)-3-(1H-pyrazol-4-yl)aniline |
| InChIKey | GPXJDHFWTOJHQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=CC=C(C=C2)Cl)C3=CNN=C3 |
Computed by PubChem (NCBI)