CAS 2445205-24-1 is the registry number for CDK4/6-IN-12, 99.76%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 100 mg, 25 mg, 5 mg, 50 mg.
12-amino-4,8-dimethyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-7-carbonitrile (CAS 2445205-24-1) is a chemical compound with the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. IUPAC name: 12-amino-4,8-dimethyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-7-carbonitrile. InChIKey: GLDQROMTPTWBPL-UHFFFAOYSA-N.
| Molecular formula | C12H10N6 |
|---|---|
| Molecular weight | 238.25 g/mol |
| IUPAC name | 12-amino-4,8-dimethyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene-7-carbonitrile |
| InChIKey | GLDQROMTPTWBPL-UHFFFAOYSA-N |
| SMILES | CC1=CN2C3=NC(=NC=C3C(=C(C2=N1)C#N)C)N |
Computed by PubChem (NCBI)