CAS 4923-06-2 is the registry number for Topiroxostat Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dipyridin-4-yl-1,2,4-triazol-1-amine (CAS 4923-06-2) is a chemical compound with the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. IUPAC name: 3,5-dipyridin-4-yl-1,2,4-triazol-1-amine. InChIKey: GHRXNZCWLXNGNG-UHFFFAOYSA-N.
| Molecular formula | C12H10N6 |
|---|---|
| Molecular weight | 238.25 g/mol |
| IUPAC name | 3,5-dipyridin-4-yl-1,2,4-triazol-1-amine |
| InChIKey | GHRXNZCWLXNGNG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NN(C(=N2)C3=CC=NC=C3)N |
Computed by PubChem (NCBI)