Products 31599-25-4

CAS 31599-25-4 appears in our catalog under these names: Isoniazid Impurity E, Isoniazid Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3,6-dipyridin-4-yl-1,4-dihydro-1,2,4,5-tetrazine (CAS 31599-25-4) is a chemical compound with the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. IUPAC name: 3,6-dipyridin-4-yl-1,4-dihydro-1,2,4,5-tetrazine. InChIKey: QWYDFEKBBFVMQW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10N6
Molecular weight238.25 g/mol
IUPAC name3,6-dipyridin-4-yl-1,4-dihydro-1,2,4,5-tetrazine
InChIKeyQWYDFEKBBFVMQW-UHFFFAOYSA-N
SMILESC1=CN=CC=C1C2=NNC(=NN2)C3=CC=NC=C3

Computed by PubChem (NCBI)