CAS 2445249-63-6 appears in our catalog under these names: 2-(Methylsulfonyl)-2,6-diazaspiro(3.3)heptane hydrochloride, 97%, 2-(Methylsulfonyl)-2,6-diazaspiro[3.3]heptane hydrochloride, 97%, 97%, 2-methylsulfonyl-2,6-diazaspiro[3.3]heptane,hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
2-methylsulfonyl-2,6-diazaspiro[3.3]heptane;hydrochloride (CAS 2445249-63-6) is a chemical compound with the molecular formula C6H13ClN2O2S and a molecular weight of 212.70 g/mol. IUPAC name: 2-methylsulfonyl-2,6-diazaspiro[3.3]heptane;hydrochloride. InChIKey: UAAMNCFORJAIOJ-UHFFFAOYSA-N.
| Molecular formula | C6H13ClN2O2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 2-methylsulfonyl-2,6-diazaspiro[3.3]heptane;hydrochloride |
| InChIKey | UAAMNCFORJAIOJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CC2(C1)CNC2.Cl |
Computed by PubChem (NCBI)