Products 24456-96-0
CAS 24456-96-0 appears in our catalog under these names: 2-tert-Butyl-5-methyl-1,4-benzoquinone, 95%, 95%, 2-(tert-Butyl)-5-methylcyclohexa-2,5-diene-1,4-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-tert-butyl-5-methylcyclohexa-2,5-diene-1,4-dione (CAS 24456-96-0) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2-tert-butyl-5-methylcyclohexa-2,5-diene-1,4-dione. InChIKey: QGICJTBKXZPCRA-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-tert-butyl-5-methylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | QGICJTBKXZPCRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=CC1=O)C(C)(C)C |
Computed by PubChem (NCBI)