Products 2445749-73-3
CAS 2445749-73-3 is the registry number for Methyl (1S,2S,3R,4R)-3-Aminobicyclo[2.2.1]hept-5-ene-2-carboxylate Hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl (1S,2S,3R,4R)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate;hydrochloride (CAS 2445749-73-3) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: methyl (1S,2S,3R,4R)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate;hydrochloride. InChIKey: PNDHULQNPIYFBJ-HXJSONIISA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | methyl (1S,2S,3R,4R)-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate;hydrochloride |
| InChIKey | PNDHULQNPIYFBJ-HXJSONIISA-N |
| SMILES | COC(=O)[C@H]1[C@H]2C[C@@H]([C@H]1N)C=C2.Cl |
Computed by PubChem (NCBI)