CAS 24464-13-9 appears in our catalog under these names: 7-Phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95+%, 7-Phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-phenyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 24464-13-9) is a chemical compound with the molecular formula C15H16ClN and a molecular weight of 245.74 g/mol. IUPAC name: 7-phenyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: STHNYDGTKSXUKF-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | 7-phenyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | STHNYDGTKSXUKF-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=CC(=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)