CAS 2446483-85-6 is the registry number for 4-Cyclopropyl-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyclopropyl-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2446483-85-6) is a chemical compound with the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. IUPAC name: 4-cyclopropyl-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: XLOBVQGJVCYPJY-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O2 |
|---|---|
| Molecular weight | 262.16 g/mol |
| IUPAC name | 4-cyclopropyl-1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | XLOBVQGJVCYPJY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NN2CC)C3CC3 |
Computed by PubChem (NCBI)