CAS 2447559-89-7 appears in our catalog under these names: (4-(Hydroxymethyl)phenyl)(imino)(methyl)-l6-sulfanone, 97%, (4-(Hydroxymethyl)phenyl)(imino)(methyl)-l6-sulfanone, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
[4-(methylsulfonimidoyl)phenyl]methanol (CAS 2447559-89-7) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: [4-(methylsulfonimidoyl)phenyl]methanol. InChIKey: QOUNQCLWQCKFOJ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | [4-(methylsulfonimidoyl)phenyl]methanol |
| InChIKey | QOUNQCLWQCKFOJ-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC=C(C=C1)CO |
Computed by PubChem (NCBI)