CAS 2448-06-8 is the registry number for N,N-Diisopropyl-3-nitrobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-nitro-N,N-di(propan-2-yl)benzamide (CAS 2448-06-8) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: 3-nitro-N,N-di(propan-2-yl)benzamide. InChIKey: UFFKMMNKRCCXPE-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3-nitro-N,N-di(propan-2-yl)benzamide |
| InChIKey | UFFKMMNKRCCXPE-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)