Products 366-74-5
CAS 366-74-5 appears in our catalog under these names: Bz–Lys–OH, Bz-lys-oh, 95%, (S)-6-Amino-2-benzamidohexanoic acid, 97%, Bz-L-Lys-OH, N-alpha-Benzoyl-L-lysine. Offered by: GLPBio, Combi-blocks, AmBeed, Iris Biotech, Biosynth. Available pack sizes: 5g, 25g, 1g, 250mg.
(2S)-6-amino-2-benzamidohexanoic acid (CAS 366-74-5) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: (2S)-6-amino-2-benzamidohexanoic acid. InChIKey: IYHOIXNPULYXFO-NSHDSACASA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2S)-6-amino-2-benzamidohexanoic acid |
| InChIKey | IYHOIXNPULYXFO-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)