Products 2449047-58-7

CAS 2449047-58-7 is the registry number for 4-Ethyl-2-(hydroxymethyl)-1-methyl-1H-imidazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-ethyl-2-(hydroxymethyl)-3-methylimidazole-4-carboxylic acid (CAS 2449047-58-7) is a chemical compound with the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. IUPAC name: 5-ethyl-2-(hydroxymethyl)-3-methylimidazole-4-carboxylic acid. InChIKey: CAOQQTCJTOGWBY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O3
Molecular weight184.19 g/mol
IUPAC name5-ethyl-2-(hydroxymethyl)-3-methylimidazole-4-carboxylic acid
InChIKeyCAOQQTCJTOGWBY-UHFFFAOYSA-N
SMILESCCC1=C(N(C(=N1)CO)C)C(=O)O

Computed by PubChem (NCBI)