CAS 24501-21-1 appears in our catalog under these names: 3–Nitropyridine–2,4–diamine, 3-Nitropyridine-2,4-diamine 95%, 3-Nitropyridine-2,4-diamine, 95%, 95%, 3-NITROPYRIDINE-2,4-DIAMINE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3-nitropyridine-2,4-diamine (CAS 24501-21-1) is a chemical compound with the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. IUPAC name: 3-nitropyridine-2,4-diamine. InChIKey: LXNNKGSAWMJWJN-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O2 |
|---|---|
| Molecular weight | 154.13 g/mol |
| IUPAC name | 3-nitropyridine-2,4-diamine |
| InChIKey | LXNNKGSAWMJWJN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)