Products 2452465-21-1
CAS 2452465-21-1 is the registry number for 6-((tert-Butoxycarbonyl)amino)pyridazine-4-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.
6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridazine-4-carboxylic acid (CAS 2452465-21-1) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridazine-4-carboxylic acid. InChIKey: NEQJAGLGEMNXKL-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridazine-4-carboxylic acid |
| InChIKey | NEQJAGLGEMNXKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NN=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)