CAS 2453251-00-6 appears in our catalog under these names: Mavacamten–d5, Mavacamten-d5, 98.61%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10 mg, 1 mg, 5 mg.
6-[[(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione (CAS 2453251-00-6) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 278.36 g/mol. IUPAC name: 6-[[(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione. InChIKey: RLCLASQCAPXVLM-MEKJEUOKSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 278.36 g/mol |
| IUPAC name | 6-[[(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione |
| InChIKey | RLCLASQCAPXVLM-MEKJEUOKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])[C@H](C)NC2=CC(=O)N(C(=O)N2)C(C)C)[2H])[2H] |
Computed by PubChem (NCBI)