CAS 2453251-02-8 is the registry number for Mavacamten-d1. Offered by: MedChemExpress. Available pack sizes: 1 mg.
6-[[(1S)-1-(4-deuteriophenyl)ethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione (CAS 2453251-02-8) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 274.34 g/mol. IUPAC name: 6-[[(1S)-1-(4-deuteriophenyl)ethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione. InChIKey: RLCLASQCAPXVLM-LLHBVIDLSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | 6-[[(1S)-1-(4-deuteriophenyl)ethyl]amino]-3-propan-2-yl-1H-pyrimidine-2,4-dione |
| InChIKey | RLCLASQCAPXVLM-LLHBVIDLSA-N |
| SMILES | [2H]C1=CC=C(C=C1)[C@H](C)NC2=CC(=O)N(C(=O)N2)C(C)C |
Computed by PubChem (NCBI)