Products 2454-35-5
CAS 2454-35-5 appears in our catalog under these names: 3'-Acetoxyacetophenone, 98%, 3'–Acetoxyacetophenone, 3'-Acetoxyacetophenone, 3'-Acetoxyacetophenone, >98.0%(GC), 3-Acetylphenyl acetate 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 100g, 1g, 5g, 250g, 5 g, 10mM/1mL.
(3-acetylphenyl) acetate (CAS 2454-35-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (3-acetylphenyl) acetate. InChIKey: OTHYPAMNTUGKDK-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (3-acetylphenyl) acetate |
| InChIKey | OTHYPAMNTUGKDK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OC(=O)C |
Computed by PubChem (NCBI)