CAS 2454397-75-0 appears in our catalog under these names: 7–Chloro–8–fluoropyrido(4,3–d)pyrimidine–2,4(1H,3H)–dione, 7-Chloro-8-fluoropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione, 96%, 96%, 7-Chloro-8-fluoropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 50g, 100mg, 250mg, 10g, 100g.
7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidine-2,4-dione (CAS 2454397-75-0) is a chemical compound with the molecular formula C7H3ClFN3O2 and a molecular weight of 215.57 g/mol. IUPAC name: 7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidine-2,4-dione. InChIKey: UQERDTKJRJNCHD-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFN3O2 |
|---|---|
| Molecular weight | 215.57 g/mol |
| IUPAC name | 7-chloro-8-fluoro-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
| InChIKey | UQERDTKJRJNCHD-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=N1)Cl)F)NC(=O)NC2=O |
Computed by PubChem (NCBI)