CAS 3031808-98-4 is the registry number for 2-Chloro-4-fluoro-5-nitrobenzimidazole, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-4-fluoro-5-nitro-1H-benzimidazole (CAS 3031808-98-4) is a chemical compound with the molecular formula C7H3ClFN3O2 and a molecular weight of 215.57 g/mol. IUPAC name: 2-chloro-4-fluoro-5-nitro-1H-benzimidazole. InChIKey: UWGVAFIOMRDQBB-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFN3O2 |
|---|---|
| Molecular weight | 215.57 g/mol |
| IUPAC name | 2-chloro-4-fluoro-5-nitro-1H-benzimidazole |
| InChIKey | UWGVAFIOMRDQBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=N2)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)