CAS 885520-10-5 is the registry number for 3-Chloro-4-fluoro-6-nitro (1h)indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-chloro-4-fluoro-6-nitro-2H-indazole (CAS 885520-10-5) is a chemical compound with the molecular formula C7H3ClFN3O2 and a molecular weight of 215.57 g/mol. IUPAC name: 3-chloro-4-fluoro-6-nitro-2H-indazole. InChIKey: HETKCEGRFLRGPE-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFN3O2 |
|---|---|
| Molecular weight | 215.57 g/mol |
| IUPAC name | 3-chloro-4-fluoro-6-nitro-2H-indazole |
| InChIKey | HETKCEGRFLRGPE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(NN=C21)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)