CAS 24544-04-5 appears in our catalog under these names: 2,6-Diisopropylaniline, 2,6-Diisopropylaniline, >95% (HPLC), 2,6–Diisopropylaniline, 2,6-Diisopropylaniline, 90+% , 2,6-Diisopropylaniline, >90.0%(GC). Offered by: Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: on request, 100g, 25g, 5g, 500ml, 500g, 25ml, 100ml.
2,6-di(propan-2-yl)aniline (CAS 24544-04-5) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: 2,6-di(propan-2-yl)aniline. InChIKey: WKBALTUBRZPIPZ-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | 2,6-di(propan-2-yl)aniline |
| InChIKey | WKBALTUBRZPIPZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N |
Computed by PubChem (NCBI)