CAS 24556-16-9 appears in our catalog under these names: Isopropyl adamantane-1-carboxylate, 95+%, 95+%, Isopropyl adamantane-1-carboxylate, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Propan-2-yl adamantane-1-carboxylate (CAS 24556-16-9) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: propan-2-yl adamantane-1-carboxylate. InChIKey: PHSXMXGYVSYRPF-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | propan-2-yl adamantane-1-carboxylate |
| InChIKey | PHSXMXGYVSYRPF-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)