CAS 2459439-16-6 appears in our catalog under these names: (1S)-1-(4-Ethylphenyl)ethan-1-amine hydrochloride, 95%, (S)–1–(4–Ethylphenyl)ethanamine hydrochloride, (1S)-1-(4-Ethylphenyl)ethan-1-amine hydrochloride, (S)-1-(4-Ethylphenyl)ethanamine hydrochloride, 95%, 95%, (S)-1-(4-Ethylphenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 0,5g.
(1S)-1-(4-ethylphenyl)ethanamine;hydrochloride (CAS 2459439-16-6) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1S)-1-(4-ethylphenyl)ethanamine;hydrochloride. InChIKey: VVCCRPRAEAGOHX-QRPNPIFTSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1S)-1-(4-ethylphenyl)ethanamine;hydrochloride |
| InChIKey | VVCCRPRAEAGOHX-QRPNPIFTSA-N |
| SMILES | CCC1=CC=C(C=C1)[C@H](C)N.Cl |
Computed by PubChem (NCBI)