Products 2460280-41-3
CAS 2460280-41-3 is the registry number for CP-201, 95.0%. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2-acetyl-5-methoxyphenyl) 2-(4-methylsulfonylphenyl)acetate (CAS 2460280-41-3) is a chemical compound with the molecular formula C18H18O6S and a molecular weight of 362.4 g/mol. IUPAC name: (2-acetyl-5-methoxyphenyl) 2-(4-methylsulfonylphenyl)acetate. InChIKey: RVVOCTZHPJJTBZ-UHFFFAOYSA-N.
| Molecular formula | C18H18O6S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2-acetyl-5-methoxyphenyl) 2-(4-methylsulfonylphenyl)acetate |
| InChIKey | RVVOCTZHPJJTBZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)OC(=O)CC2=CC=C(C=C2)S(=O)(=O)C |
Computed by PubChem (NCBI)