CAS 3878-43-1 is the registry number for 2,2'-(((Sulfonylbis(4,1-phenylene))bis(oxy))bis(methylene))bis(oxirane), 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]sulfonylphenoxy]methyl]oxirane (CAS 3878-43-1) is a chemical compound with the molecular formula C18H18O6S and a molecular weight of 362.4 g/mol. IUPAC name: 2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]sulfonylphenoxy]methyl]oxirane. InChIKey: RLTACIWKRKVZKZ-UHFFFAOYSA-N.
| Molecular formula | C18H18O6S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]sulfonylphenoxy]methyl]oxirane |
| InChIKey | RLTACIWKRKVZKZ-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC=C(C=C2)S(=O)(=O)C3=CC=C(C=C3)OCC4CO4 |
Computed by PubChem (NCBI)