CAS 568567-08-8 appears in our catalog under these names: (2E)-3-(4-([(2,5-Dimethylphenyl)sulfonyl]oxy)-3-methoxyphenyl)acrylic acid, 95%, 3-{4-((2,5-dimethylbenzenesulfonyl)oxy)-3-methoxyphenyl}prop-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-3-[4-(2,5-dimethylphenyl)sulfonyloxy-3-methoxyphenyl]prop-2-enoic acid (CAS 568567-08-8) is a chemical compound with the molecular formula C18H18O6S and a molecular weight of 362.4 g/mol. IUPAC name: (E)-3-[4-(2,5-dimethylphenyl)sulfonyloxy-3-methoxyphenyl]prop-2-enoic acid. InChIKey: NHZJKYKLWSIVRG-VQHVLOKHSA-N.
| Molecular formula | C18H18O6S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (E)-3-[4-(2,5-dimethylphenyl)sulfonyloxy-3-methoxyphenyl]prop-2-enoic acid |
| InChIKey | NHZJKYKLWSIVRG-VQHVLOKHSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)OC2=C(C=C(C=C2)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)