CAS 2460749-34-0 appears in our catalog under these names: 7-(4-Methylpiperazin-1-yl)pyrido(3,2-d)pyrimidin-4-ol, 98%, 7-(4-Methylpiperazin-1-yl)pyrido[3,2-d]pyrimidin-4-ol, 96%, 96%, 7-(4-methylpiperazin-1-yl)-1H,4H-pyrido[3,2-d]pyrimidin-4-one, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
7-(4-methylpiperazin-1-yl)-3H-pyrido[3,2-d]pyrimidin-4-one (CAS 2460749-34-0) is a chemical compound with the molecular formula C12H15N5O and a molecular weight of 245.28 g/mol. IUPAC name: 7-(4-methylpiperazin-1-yl)-3H-pyrido[3,2-d]pyrimidin-4-one. InChIKey: NNVFQRLNLBFCJW-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 7-(4-methylpiperazin-1-yl)-3H-pyrido[3,2-d]pyrimidin-4-one |
| InChIKey | NNVFQRLNLBFCJW-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C(=O)NC=N3)N=C2 |
Computed by PubChem (NCBI)