CAS 930560-86-4 is the registry number for N-(4-(1H-Tetrazol-1-yl)phenyl)pivalamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-N-[4-(tetrazol-1-yl)phenyl]propanamide (CAS 930560-86-4) is a chemical compound with the molecular formula C12H15N5O and a molecular weight of 245.28 g/mol. IUPAC name: 2,2-dimethyl-N-[4-(tetrazol-1-yl)phenyl]propanamide. InChIKey: OPHFIZLBIDRCEQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 2,2-dimethyl-N-[4-(tetrazol-1-yl)phenyl]propanamide |
| InChIKey | OPHFIZLBIDRCEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=C(C=C1)N2C=NN=N2 |
Computed by PubChem (NCBI)